pour la recherche uniquement
Réf. CatalogueS7023
| Cibles apparentées | Bcl-2 PD-1/PD-L1 Ferroptosis p53 Apoptosis related Synthetic Lethality STAT TNF-alpha Ras KRas |
|---|---|
| Autre Caspase Inhibiteurs | Emricasan (IDN-6556) Q-VD-Oph Z-DEVD-FMK Belnacasan (VX-765) Z-IETD-FMK Ac-DEVD-CHO Z-LEHD-FMK TFA Z-VAD(OH)-FMK PAC-1 Z-YVAD-FMK |
| Lignées cellulaires | Type dessai | Concentration | Temps dincubation | Formulation | Description de lactivité | PMID |
|---|---|---|---|---|---|---|
| Molt-3 | Apoptosis Assay | 50μM | 2h | reduces melatonin-induced apoptosis | 23725013 | |
| Jurkat | Cell Viability Assay | 100-200μM | 24h | inhibits HaA4 induces apoptosis dependent of concentration | 23732481 | |
| T98G | Cell Viability Assay | 1-100μM | 24h | improves cell viability cotreatment with TS | 23769275 | |
| RKO | Cell Viability Assay | 10 μM | 24h | inhibits the decrease of cell viability caused by DAB | 23758064 | |
| Ec-109 | Apoptosis Assay | 10 μM | 48h | represses PE-mediated Ec-109 cell apoptosis | 23782641 | |
| HL-60 | Apoptosis Assay | 50µM | 4h | blocks the cleavage of caspase-3, -9, and PARP induced by 6s | 23804706 | |
| U251 | Apoptosis Assay | 20μM | 24h | inhibits casticin induced G2/M phase arrest and apoptosis | 23816816 | |
| HeLa | Apoptosis Assay | 20μM | 2h | inhibits DMMP induced apoptosis | 23863966 | |
| HL-60 | Apoptosis Assay | 100μM | 24h | inhibits apoptosis induced by abietane diterpenes | 23865778 | |
| K562 | Apoptosis Assay | 20μM | 48h | inhibits apoptosis induced by 4-MU | 23876826 | |
| THP-1 | Apoptosis Assay | 10-50μM | 2h | inhibits apoptosis induced by triptolide | 23900299 | |
| CAL27 | Apoptosis Assay | 10 μM | 2h | suppresses Cur-NPs-reduced viability by up to 90% | 23917396 | |
| COS-7 | Function Assay | 50µM | 24h | affects the processing of ATN1s with polyQ tracts | 23933208 | |
| Jurkat | Cell Viability Assay | 25-100μM | 6h | inhibits z-FA-CMK-induced cell death | 23933532 | |
| A431 | Kinase Assay | 40μM | 2h | blocks fisetin-induced cleavage of caspases and PARP | 23800058 | |
| RAW264.7 | Apoptosis Assay | 10 μM | 24h | decreases the apoptosis induced by GA | 23820203 | |
| Jurkat | Cell Viability Assay | 2μM | 4h | reverses growth inhibition and β-catenin decrease by HS-ASA | 23896061 | |
| L929 | Apoptosis Assay | 1.25–5 μM | 24h | augments TNFα-induced necroptosis and autophagy | 23941769 | |
| HL-60 | Apoptosis Assay | 50µM | 1h | DMSO | inhibits apoptosis induced by BA145 | 23948751 |
| CNE2 | Apoptosis Assay | 20μM | 48h | blocks LK-A-induced apoptosis | 23985029 | |
| CNE1 | Apoptosis Assay | 20μM | 48h | blocks LK-A-induced apoptosis | 23985029 | |
| IM-9 B | Apoptosis Assay | 20μM | 2h | DMSO | blocks anti-CD80 and anti-CD86 antibody-induced apoptosis | 24008628 |
| EBV-transformed B cells | Apoptosis Assay | 20μM | 2h | DMSO | blocks anti-CD80 and anti-CD86 antibody-induced apoptosis | 24008628 |
| MG-63 | Apoptosis Assay | 40μM | 24h | blocks the increased cleavage of caspase-3 and PARP induced by BBMD3 | 24025361 | |
| G292 | Apoptosis Assay | 40μM | 24h | blocks the increased cleavage of caspase-3 and PARP induced by BBMD3 | 24025361 | |
| KHOS | Apoptosis Assay | 40μM | 24h | blocks the increased cleavage of caspase-3 and PARP induced by BBMD3 | 24025361 | |
| Nalm-6 | Apoptosis Assay | 20μM | 4h | inhibits caspase-8 and caspase-3 activation and PARP-1 cleavage | 24039967 | |
| BGC-823 | Apoptosis Assay | 10 μM | 24h | reduces tetrandrine-induced apoptosis | 24098511 | |
| UM-SCC-10A | Apoptosis Assay | 50µM | 2h | reduces apoptosis induced by high-dose isoalantolactone | 24098753 | |
| A549 | Apoptosis Assay | 2.5μM | 24h | decreases oridonin-induced autophagy as well and Loss of Δψm also occurred during autophagic process | 24102522 | |
| RAW 264.7 | Apoptosis Assay | 20μM | 18h | increases LC3-II/β-actin ratio compared to ECTV-MOS treatment only | 24116707 | |
| SCCVII | Apoptosis Assay | 25μM | 1h | inhibits the cell killing after | 24126464 | |
| HeLa | Apoptosis Assay | 10/20μM | 24h | inhibits the activity of the majority of the members of the caspase-family | 24137266 | |
| SH-SY5Y | Apoptosis Assay | 10μM | 24h | attenuates caspase activation and cell death induced by HNE-2DG | 24145463 | |
| UD29a | Apoptosis Assay | 50μM | 24h | inhibits the cell death caused by NUT3 | 24190574 | |
| RPE | Apoptosis Assay | 100μM | 48h | partially inhibits the calpain-1 and -2 activation as well as the caspase activation | 24202052 | |
| OS | Apoptosis Assay | 20μM | 4h | inhibits the cell death caused by PDT | 24204937 | |
| 4T1 | Cell Viability Assay | 2.5-10μM | 4h | DMSO | rescues the cytotoxicity of 4T1 cells induced by SPDT in a concentration dependent manner | 24206161 |
| HEC-1B | Apoptosis Assay | 20μM | 1h | reduces TP-induced apoptosis caspase-3 and caspase-9 | 24213358 | |
| RKO-HIPK2i | Apoptosis Assay | 40μM | 6h | inhibits apoptosis induced by chemotherapy plus ZnCl2 | 24228232 | |
| U373 | Apoptosis Assay | 40μM | 6h | inhibits apoptosis induced by chemotherapy plus ZnCl2 | 24228232 | |
| ADF | Apoptosis Assay | 40μM | 6h | inhibits apoptosis induced by chemotherapy plus ZnCl2 | 24228232 | |
| MCC-2 | Apoptosis Assay | 20 μM | 6h | DMSO | blocks induced by staurosporine apoptosis cell death | 24262658 |
| A549 | Apoptosis Assay | 100μM | 48h | suppresses the apoptosis caused by piperine | 24272201 | |
| 5637 | Apoptosis Assay | 20μM | 1h | reverses CM-induced cell death | 24282433 | |
| MB49 | Apoptosis Assay | 20μM | 1h | reverses CM-induced cell death | 24282433 | |
| PDL fibroblasts | Kinase Assay | 80μM | 1h | inhibits Caspase-3 activity | 24314135 | |
| fetal rat lung fibroblasts | Kinase Assay | 80μM | 1h | inhibits Caspase-3 activity | 24314135 | |
| HepG2 | Apoptosis Assay | 10μM | 24h | reduces vimentin cleavage caused by LPS | 24325816 | |
| KB | Apoptosis Assay | 50μM | 24h | inhibits Lico-A-induced caspase-3 and PARP activation | 24337492 | |
| podocytes | Apoptosis Assay | 200μM | 6h | inhibits apoptosis induced by 3,4-DGE | 24337777 | |
| HaCaT | Apoptosis Assay | 100μM | 1h | blunts UVB-induced apoptosis in HaCaT cells | 24356997 | |
| k1735 | Apoptosis Assay | 20 μm | 4h | inhibits Salmonella-induced apoptosis | 24451116 | |
| SGC-7901 | Apoptosis Assay | 10μM | 24h | promotes the CGII-inhibited cell growth in SGC-7901 cells | 24454488 | |
| CLL | Apoptosis Assay | 25μM | 1h | partially blocks MLN2238-induced cell apoptosis | 24467634 | |
| Caki-1 | Apoptosis Assay | 20μM | 1h | inhibits SCP-induced apoptosis | 24504681 | |
| MIA-PaCa-2 | Apoptosis Assay | 24h | blocks cleavage of caspase-3 induced by both A-443654 and paclitaxel | 24510992 | ||
| A549 | Apoptosis Assay | 5μM | 24h | suppresses 6e (BK10040)-induced apoptosis | 24529871 | |
| HT-29 | Apoptosis Assay | 50μM | 48h | blocks the apoptosis induced by kaempferol | 24549175 | |
| BV-2 | Apoptosis Assay | 20μM | 2h | suppresses UV-induced chromatin extrusion and dilation of the nuclear envelope | 24558118 | |
| A549 | Apoptosis Assay | 50µM | 2h | DMSO | prevents the hypodiploid DNA content phase induced by cephalochromin | 24588135 |
| HDPC | Apoptosis Assay | 50µM | 24h | inhibits NO-induced apoptosis | 24634593 | |
| A375 | Apoptosis Assay | 20μM | 24h | reverses dicitrinone B-induced apoptosis | 24699111 | |
| L02 | Apoptosis Assay | 20μM | 1h | prevents the cell apoptosis induced by MEHP | 24706461 | |
| HCT116 | Apoptosis Assay | 20μM | 24h | inhibits the cell apoptotic induced by YLT205 | 24713812 | |
| IEC-6 | Apoptosis Assay | 10μM | 24h | prevents TcdA-induced caspase-3 cleavage and β-catenin degradation | 24711571 | |
| HeLa | Apoptosis Assay | 100μM | 24h | suppresses rate of cell death induced by overexpression of G59S or G71R p150glued | 24722468 | |
| HeLa | Apoptosis Assay | 50μM | 72h | DMSO | prevents apoptosis induced by compounds 1–5 | 24754786 |
| T cell | Cell proliferation assay | 0-100μM | 72h | IC50=70 μM, inhibits anti-CD3-induced T cell proliferation in PBMCs | 24768707 | |
| U937 | necroptosis Assay | 10 μM | 30 min | induces necroptosis combine with TNF | 24773756 | |
| LCC9 | Cell Viability Assay | 100μM | 5d | blocks cell death induced by combination L17 and | 24785256 | |
| AGS | Apoptosis Assay | 20μM | 12h | DMSO | reduces the induction of apoptosis in response to the EtOAc fraction in a dose-dependent manner | 24789703 |
| macrophage | Cell Viability Assay | 0-200μM | 24h | induces TNF- and Rip3-dependent necroptosis in macrophage | 24799565 | |
| Caco-2 | Apoptosis Assay | 40 μM | 4h | prevents ST-7-induced ZO-1 changes and TER drop | 24822183 | |
| SNU449 | Apoptosis Assay | 20μM | 48h | DMSO | decreases miR-451-induced apoptotic | 24841638 |
| LOVO | Apoptosis Assay | 10 µM | 1h | DMSO | restrains cell apoptosis induced by plus | 24874286 |
| SW1116 | Apoptosis Assay | 10 µM | 1h | DMSO | restrains cell apoptosis induced by plus | 24874286 |
| HCT116 | Apoptosis Assay | 20μM | 24h | abrogates of TQ-induced apoptosi | 24890449 | |
| P815 | Apoptosis Assay | 100 µM | 12h | DMSO | inhibits virus-induced apoptosis | 24923273 |
| THP-1 | Apoptosis Assay | 10μM | 1h | reduces apoptosis induced by ALA-SDT | 24923653 | |
| HeLa | Apoptosis Assay | 40μM | 24h | inhibits the increased apoptosis induced by siRNF121 | 24928685 | |
| AGS | Apoptosis Assay | 50μM | 24h | abolishs β-lapachone-induced cell death and inhibited growth | 25009698 | |
| C6 | Apoptosis Assay | 50μM | 48h | prevents the loss of cell viability caused by pregnenolone | 25013479 | |
| MM.1S | Apoptosis Assay | 100μM | 1h | efficiently prevents sorafenib-induced cell death combine with necrostatin-1 | 25037851 | |
| H929 | Apoptosis Assay | 100μM | 1h | partially blocks cell death caused by necrostatin-1 | 25037851 | |
| U266 | Apoptosis Assay | 100μM | 1h | partially blocks cell death caused by necrostatin-1 | 25037851 | |
| RPMI 8226 | Apoptosis Assay | 100μM | 1h | almost completely blocks cell death caused by necrostatin-1 | 25037851 | |
| IMR-32 | Apoptosis Assay | 40 μM | 2h | decrease in apoptotic cells compared to T-2 toxin | 25084755 | |
| K562 | Apoptosis Assay | 0.1-1μM | 1h | inhibits cleavage of HSP90 in a dose-dependent manner | 25119188 | |
| Jurkat | Apoptosis Assay | 20μM | 24h | DMSO | partially inhibit cell death of Jurkat cells induced by 10058-F4 combined with VPA | 25120723 |
| Ebs | Apoptosis Assay | 10-100μM | 24h | MMTS generation rate decreased as the concentration of z-VAD.fmk increased | 25134817 | |
| EA.hy926 | Apoptosis Assay | 10μM | 2h | inhibits apoptosis and facilitates autophagy in DENV2-infected EA.hy926 | 25138703 | |
| HUVECs | Apoptosis Assay | 10μM | 2h | inhibits apoptosis and facilitates autophagy in DENV2-infected HUVECs | 25138703 | |
| OS | Apoptosis Assay | 20/40μM | 72h | inhibits OS cell viability reduction by C6 ceramide | 25152399 | |
| MCF-7 | Apoptosis Assay | 20μM | 2h | decreases KDR-siRNA-induced apoptosis | 25182240 | |
| A549 | Apoptosis Assay | 10μM | 3h | reduces cell apoptosis caused by PQQ | 25161699 | |
| L929 | Apoptosis Assay | 10μM | 6h | induces necroptosis with TNF | 25195660 | |
| K562 | Apoptosis Assay | 50μM | 4h | inhibits Jac-A-induced cell apoptosis | 25241619 | |
| H9c2 | Apoptosis Assay | 50μM | 1h | inhibits DOX-induced caspase 3 activation but not the loss of cells | 25283819 | |
| 769-P | Apoptosis Assay | 40μM | 48h | reduces the number of Annexin V-positive cells | 25279191 | |
| Caki-1 | Apoptosis Assay | 40μM | 48h | reduces the number of Annexin V-positive cells | 25279191 | |
| NBL-W-S | Apoptosis Assay | 50μM | 1h | fully rescues cell viability after GANT-61 treatment | 25323222 | |
| A549 | Apoptosis Assay | 2.5-25μM | 1h | decreases the population of apoptotic cells depend on concentrations | 25342427 | |
| A549 | Apoptosis Assay | 50μM | 24h | reverses ribosome biogenesis and apoptosis caused by Chijongdan | 25349781 | |
| A375 | Apoptosis Assay | 30μM | 2h | prevents the drug-induced PARP cleavage | 25376115 | |
| COS7 | Apoptosis Assay | 10μM | 48h | partially prevented FC101-induced cell death | 25384025 | |
| COS7 | Kinase Assay | 10μM | 24h | increases caspase 3/7 activities | 25384025 | |
| Cytotoxicity Assay | Cell Viability Assay | 20μM | 48h | prevent MHMD-induced cell death | 25392116 | |
| L929-N | Cytotoxicity Assay | 20 μM | 24h | enhances death via autocrine TNFα production | 25398540 | |
| L929-A | Cytotoxicity Assay | 20 μM | 24h | inhibits TNFα-induced cell death | 25398540 | |
| Primary hepatocytes | Apoptosis Assay | 50μM | 18h | inhibits apoptosis of hepatocytes induced by Act D and TNF-α | 25407538 | |
| INS-1 | Apoptosis Assay | 50μM | 6h | DMSO | decreases the proportion of early apoptotic cells | 25430897 |
| A549 | Apoptosis Assay | 10μM | 24h | blocks DMAS-induced cleavage of caspase-3 and PARP and apoptotic cell death | 25434989 | |
| AGS | Apoptosis Assay | 10μM | 1h | prevents curcumin-induced cleavage of caspase-3, -8, and -9 proteins | 25492214 | |
| HL-60 | Cytotoxicity Assay | 100μM | 1h | DMSO | improves viability of TCNAs-treated cells | 25502932 |
| MKN28 | Apoptosis Assay | 10μM | 30min | DMSO | inhibits TNF-α plus CHX-induced apoptosis | 25513960 |
| MDA-MB-231 | Cytotoxicity Assay | 10μM | 1h | augments cell death after CHUA treatment | 25521501 | |
| DLD1 | Apoptosis Assay | 20 μM | 1h | partly reverses cell apoptosis caused by WSP1 | 25524246 | |
| MM | Apoptosis Assay | 50μM | 20min | partly inhibits SHK-induced cell death | 25530098 | |
| Primary human placental cytotrophoblasts | Apoptosis Assay | 30μM | 24h | DMSO | reverses the inhibition of 11β-HSD2 by triclosan | 25642592 |
| Neocortical Neuron | Neurotoxicity Assay | 100μM | 1h | antagonizes Hoiamide A-Induced Neurotoxicity | 25675001 | |
| U87 | Growth Inhibition Assay | 50μM | 1h | recovers cell growth from TMZ treatment | 25681668 | |
| A549 | Apoptosis Assay | 10 μM | 24h | DMSO | promotes HBC-treated A549 cell survival & attenuates the cleaved PARP expression | 25683568 |
| MCF-7 | Apoptosis Assay | 10μM | 2h | inhibits the cell death induced by 3B | 25722114 | |
| SGC-7901 | Apoptosis Assay | 20 μM | 1h | inhibits the cell death induced by oxaliplatin | 25767076 | |
| HeLa | Apoptosis Assay | 10μM | 48h | declines the rate of apoptosis dramatically | 25772545 | |
| A549 | Apoptosis Assay | 20 μM | 24h | reduces cell death caused by HFCP treatment | 25794149 | |
| GC1a | Apoptosis Assay | 50μM | 24h | indicates a protective effect against | 26169075 | |
| HGL5 | Apoptosis Assay | 50μM | 24h | indicates a protective effect against | 26169075 | |
| HepG2 | Apoptosis Assay | 20μM | 1h | attenuated the apoptotic induction of III-10 | 26164795 | |
| BEL-7402 | Apoptosis Assay | 20μM | 1h | attenuated the apoptotic induction of III-10 | 26164795 | |
| CEF | Kinase Assay | 0,33,67,100μM | 15min | down-regulates PR enzyme activity to 40% at 100μM | 26102339 | |
| SP2/0 | Apoptosis Assay | 100μM | 1h | DMSO | blocks the apoptosis of SP2/0 cells | 26074732 |
| HUVEC-2c | Apoptosis Assay | 50μM | 6h | decreased the ox-LDL-induced autophagy | 26021729 | |
| U1 | Apoptosis Assay | 0-100μM | 2h | reduces drug-induced apoptosis and subsequent HIV-1 replication in a dose-dependent manner | 25980942 | |
| ACH-2 | Apoptosis Assay | 0-200μM | 2h | reduces drug-induced apoptosis and subsequent HIV-1 replication in a dose-dependent manner | 25980942 | |
| U1 | Kinase Assay | 100μM | 2h | inhibits caspase-3 | 25980942 | |
| A549/V16 | Apoptosis Assay | 50μM | 1h | represses TG/TM-induced apoptosis | 25946033 | |
| SGN | Apoptosis Assay | 20mM | 48h | has no influence on AIF, calpain expression or cell apoptosis | 25874633 | |
| HCT116 | Apoptosis Assay | 50μM | 2h | inhibits the cell death induced by DDVP | 25868818 | |
| DTK-SME | Apoptosis Assay | 50μM | 2h | DMSO | partially inhibits the apoptosis induced by bupivacaine | 25843897 |
| HL-60 | Apoptosis Assay | 50μM | 48h | reduces cell death caused by SKI-II treatment | 25824043 | |
| U937 | Apoptosis Assay | 50μM | 48h | reduces cell death caused by SKI-II treatment | 25824043 | |
| hMSC12 | Apoptosis Assay | 100μM | 4d | inhibits osteogenic culture-induced cell death and calcification | 23657822 | |
| HM7 | Apoptosis Assay | 20μM | 1h | blocks apicularen A acetate-induced caspase-3 activation and PARP cleavage | 23583412 | |
| Hep-2 | Apoptosis Assay | 20μM | 24h | DMSO | alleviates the decrease of cell viability induced by silibinin | 23580032 |
| HSCs | Apoptosis Assay | 50μM | 24h | DMSO | inhibits nilotinib-induced DNA damage indicated by PARP cleavage | 23499874 |
| HL-60 | Cytotoxicity Assay | 20μM | 24h | reduces the cytotoxic effect of Ery5 | 23494480 | |
| HA | Apoptosis Assay | 50μM | 24h | suppresses the cleavage of PARP and caspase-3, -7, and -9 induced by | 23475956 | |
| C666-1 | Apoptosis Assay | 50μM | 24h | suppresses the cleavage of PARP and caspase-3, -7, and -9 induced by | 23475956 | |
| Hepa1-6 | Apoptosis Assay | 50μM | 2h | inhibits curcumin and resveratrol-induced apoptosis | 23446753 | |
| PLC/PRF/5c | Apoptosis Assay | 50μM | 1h | prevents apoptosis triggered by CIN | 23438824 | |
| HCT116 | Apoptosis Assay | 100μM | 1.5h | inhibits Os-induced cell death | 23744353 | |
| HCEC | Function Assay | 50μM | 72h | DMSO | restores of the normal HCEC phenotype | 23742011 |
| Primary rat cerebral cortical neurons | Apoptosis Assay | 100μM | 1h | prevents Cd-induced apoptosis and cell death | 23741317 | |
| MDA-MB-231 | Apoptosis Assay | 25μM | 24h | abrogates cytotoxicity and cleavage of caspase-3 and PARP induced by Rg3 | 25337544 | |
| NLRP3-Tet-on-MC/9 | Apoptosis Assay | 10-40μM | 12h | attenuates the cell death caused by CAPS-associated NLRP3 mutants in the Tet-on system | 23703389 | |
| KNS42 | Apoptosis Assay | 50μM | 1h | reduces cell death and completely abolished caspase 3/7 activity in response to ABT-263/2DG/ combination | 23691145 | |
| MCF-7 | Apoptosis Assay | 20μM | 72h | inhibits equol- and 4-OHT-mediated apoptosis | 23675643 | |
| hCMEC/D3 | Apoptosis Assay | 25μM | 72h | reduces LtxA induced apoptosis | 23665198 | |
| Jurkat | Apoptosis Assay | 12.5-50μM | 1h | dose dependently suppresses SPH-induced Par-4 cleavage, PARP cleavage, DNA fragmentation, and loss of viability | 23442976 | |
| CNE-1 | Apoptosis Assay | 20μM | 24h | inhibits RAD001-induced cell death | 23426850 | |
| HONE-1 | Apoptosis Assay | 20μM | 24h | inhibits RAD001-induced cell death | 23426850 | |
| astrocytes cell | Apoptosis Assay | 40μM | 6h | reduces early apoptosis induced by staurosporine | 23411778 | |
| U-937 | Apoptosis Assay | 10μM | 30min | prevents TNF-induced necroptosis | 23410748 | |
| MDA-MB-231 | Apoptosis Assay | 100μM | 1h | inhibits sensitization to TRAIL upon MTDH down-regulation | 23408429 | |
| HeLa | Apoptosis Assay | 100μM | 2h | blocks JRS-15 Induces Apoptotic Cell Death | 23344045 | |
| Ec109 | Apoptosis Assay | 10μM | 6h | blocks apoptotic combination of Tat-SmacN7 and radiation | 23338568 | |
| H460 | Apoptosis Assay | 10μM | 6h | blocks apoptotic combination of Tat-SmacN7 and radiation | 23338568 | |
| HeLa | Apoptosis Assay | 50μM | 1.5h | abrogates Chlamydia-induced apoptosis | 23303804 | |
| SK-HEP1 | Apoptosis Assay | 100μM | 1h | inhibits CrT1 activated caspase-3, -7, -8, -9, and poly(ADP-ribose) polymerase | 23302650 | |
| QGY7701 | Apoptosis Assay | 25μM | 1.5h | inhibits accumulation of sub-G1 phase induced by DOX + quercetin | 23240061 | |
| HepG2 | Apoptosis Assay | 20μM | 30min | inhibits the enhanced cell death by combined treatment of apigenin and TRAIL | 23224239 | |
| U87 | Apoptosis Assay | 25μM | 2h | decreases isoliquiritigenin (ISL)-induced apoptotic cell death, but not necrotic cell death | 23229626 | |
| HSC-2 | Apoptosis Assay | 25/50μM | 1h | inhibits SN-38-induced cytotoxicity | 23155248 | |
| HSC-4 | Apoptosis Assay | 25/50μM | 1h | inhibits SN-38-induced cytotoxicity | 23155248 | |
| CL-1 | Apoptosis Assay | 20μM | 1h | blocks OP449 induced cell death | 23131782 | |
| MEL | Apoptosis Assay | 20μM | 24h | DMSO | impaires P2X7-induced MEL cell apoptosis | 23014887 |
| Bel-7402 | Caspase Activation Assay | 50μM | 2h | inhibits PCE-induced anoikis | 23008742 | |
| Eca-109 | Apoptosis Assay | 25μM | 30min | inhibits BJ-B11-induced cell death | 23076967 | |
| MEL | Apoptosis Assay | 20μM | 1h | DMSO | impaires P2X7-induced MEL cell apoptosis | 23014887 |
| Bel-7402 | Apoptosis Assay | 50μM | 2h | inhibits PCE-induced anoikis | 23008742 | |
| L929 | Function Assay | 2.5μM | 1h | increases RIP1 expression and exacerbated TNFα-induced mitochondrial dysfunction and ROS production | 23000518 | |
| RCC | Cell Viability Assay | 100μM | 24h | recoveres the viability of cells exposed to 15d-PGJ2 | 22991494 | |
| NB2a/d1 | Apoptosis Assay | 100μM | 72h | attenuates staurosporine-induced caspase activity, PARP, and tau cleavage | 22988541 | |
| T cell | Growth Inhibition Assay | 25-100μM | 24h | dose-dependently inhibited T cell proliferation mediated through the co-stimulation with anti-CD3 and anti-CD28 | 22982538 | |
| K562 | Apoptosis Assay | 100μM | 1h | blocks Abnobaviscum F-induced apoptosis | 22972372 | |
| Jurkat | Apoptosis Assay | 40μM | 1h | abolishes FasL-induced caspase activation and cell death | 22942738 | |
| BGC-823 | Apoptosis Assay | 100μM | 1h | partially rescues cells against damage of daidzein | 22926545 | |
| Hep3B | Apoptosis Assay | 50μM | 1h | blocks apoptosis induced by HEGCs | 22923154 | |
| LLC-PK1 | Apoptosis Assay | 20μM | 1h | prevents degradation of Atg5, beclin-1, and Atg12 proteins | 22896037 | |
| A549 | Apoptosis Assay | 50μM | 1h | blocks the BAI-induced apoptosis | 22887215 | |
| SGC-7901 | Apoptosis Assay | 10μM | 24h | inhibits β,β-dimethylacrylshikonin-induced apoptosis | 22848597 | |
| DM6 | Apoptosis Assay | 100μM | 72h | blocks both E2F-1 and E2Ftr-mediated cytotoxicity | 22825328 | |
| MCF-7, MDA-MB-468, Caco-2 | Growth Inhibition Assay | 50μM | 48h | inhibits the cell growth inhibition induced by saponin | 22800968 | |
| A2750 | Apoptosis Assay | 20μM | 2h | DMSO | blocks caspase cleavage during helenalin treatment and reduces autophagic cell death | 22784363 |
| U87 | Apoptosis Assay | 20μM | 24h | reduces the apoptosis rate induced by PLAB | 22778780 | |
| HT1080 | Growth Inhibition Assay | 50μM | 7d | inhibits the cell growth inhibition caused by combined treatment of DCA and OMP | 22740984 | |
| A549 | Apoptosis Assay | 50μM | 2h | partially decreases sodium selenite-induced apoptosis | 22721804 | |
| Primary OPC | Apoptosis Assay | 1μM | 6h/24h | reduces the percentage of cells in early- and late-apoptosis/necrosis | 22707385 | |
| PMNs | Apoptosis Assay | 40μM | 6h | DMSO | reversed the amount of cleaved caspase-3 to near vehicle levels | 22692577 |
| A549 | Apoptosis Assay | 50μM | 1h | prevents apoptosis induced by Baohuoside I | 22687635 | |
| AGS | Apoptosis Assay | 20μM | 12h | inhibits the activation of pro-caspase-3 in response to the EtOAc fraction | 22687398 | |
| shC9 | Apoptosis Assay | 10μM | 16h | blunts SHH expression in shC9 cells exposed to either PA or LPC | 22641094 | |
| primary MEFs | Function Assay | 12h | increases mitochondrial membrane depolarization | 22613767 | ||
| 3T9 MEFs | Function Assay | 16h | increases cytochrome c release after | 22613767 | ||
| 3T9 MEFs | Function Assay | 18h | upregulates initiator caspase-9 but downregulates effector caspases after treatment | 22613767 | ||
| MDA-MB-231 | Apoptosis Assay | 20μM | 4d | reduces the cell apoptosis induced by treatment was significantly | 22593441 | |
| C6 | Apoptosis Assay | 10μM | 24h | blocks the suppressive effect of the peptide on viability | 22588980 | |
| HL-60 | Apoptosis Assay | 100μM | 24h | inhibits the cell apoptosis selected (+)-menthyl β-(1→6)-diglucopyranoside 5 | 22546669 | |
| HL-60 | Apoptosis Assay | 10-80μM | 4h | inhibits TGHQ-induced cell apoptosis | 22523229 | |
| BCC | Apoptosis Assay | 50μM | 1h | inhibits DATS-mediated growth inhibition | 22519436 | |
| RAW 264.7 | Apoptosis Assay | 50/100μM | 1h | concentration-dependent inhibits DON-induced rRNA cleavage | 22491426 | |
| K562 | Apoptosis Assay | 25μM | 2h | prevents apoptosis induced by co-treatment with amurensin G and TRAIL | 22483777 | |
| SGC-7901 | Apoptosis Assay | 20 μM | 2h | attenuates H2O2 or TNF α-induced cell apoptosis as well as caspase-3 activity | 22471589 | |
| PC3 | Apoptosis Assay | 10μM | 4h | counters flavocoxid-induced caspase-related apoptosis | 22471974 | |
| SMMC-7721 | Apoptosis Assay | 50μM | 48h | attenuates oTR-induced apoptosis | 22465833 | |
| HeLa | Apoptosis Assay | 50 μM | 4/8h | inhibits STS-induced late-phase apoptotic events | 22460504 | |
| HeLa | Apoptosis Assay | 50 μM | 1h | suppresses the FRAP-induced accumulation of annexin V positive cells | 22449440 | |
| T47D | Apoptosis Assay | 100μM | 1h | blocks the generation of E-cad/CTF2 by STS | 22401168 | |
| HeLa | Apoptosis Assay | 30μM | 4h | increases the general cell viability 48 h after photodynamic treatment | 22394248 | |
| HCC | Apoptosis Assay | 20 μM | 2h | attenuates the DHA induced activation of PARP | 22342732 | |
| mESCs | Apoptosis Assay | 2.5μM | 2h | inhibits the NaF-mediated caspase activation | 22285274 | |
| EMT-6 | Cytotoxicity Assay | 100μM | 1h | partially blocked cell death induced by siramesine | 22251921 | |
| MCF7 | Apoptosis Assay | 50 μM | 1h | inhibits PA activated caspase-3, -9, and poly(ADP-ribose) polymerase | 22223345 | |
| K562 | Apoptosis Assay | 20 μM | 48h | DMSO | blocks inhibition of viability and apoptosis induction | 22216158 |
| Molt4-hyg | Apoptosis Assay | 10μM | 0.5h | blocks farnesol-induced caspase-3-like activity | 26275811 | |
| HeLa | Apoptosis Assay | 10μM | 0.5h | inhibits apoptosis induced by the combined treatment with gomisin N and TRAIL | 22179661 | |
| Jurkat T | Apoptosis Assay | 30μM | 0.5h | DMSO | blocks the ziram-induced apoptosis | 22159898 |
| Neutrophil | Apoptosis Assay | 20μM | 0.5h | attenuates the pro-apoptotic effect of MaR1 | 26196844 | |
| HCT116 | Apoptosis Assay | 50 μM | 2h | reverses synergistic apoptosis effects of and NPC-16 | 22159752 | |
| MDA-MB-231 | Apoptosis Assay | 2.5-7.5μM | 2h | inhibits the cell death of MDA-MB-231 cells induced by SDT in a concentration dependent manner | 22115526 | |
| LNCaP | Apoptosis Assay | 40μM | 2h | inhibits butein induced cell apoptosis | 22114764 | |
| MB231 | Apoptosis Assay | 100μM | 1h | DMSO | abrogates the induction of cell death by WEE1 inhibition, TRAIL treatment, and the combination | 22112940 |
| HCC38 | Apoptosis Assay | 100μM | 1h | DMSO | abrogates the induction of cell death by WEE1 inhibition, TRAIL treatment, and the combination | 22112940 |
| MDA-MB231 | Apoptosis Assay | 50 μM | 24h | DMSO | abrogates curcumin-induced cell death | 22101335 |
| LNCaP | Apoptosis Assay | 50 μM | 24h | DMSO | abrogates curcumin-induced cell death | 22101335 |
| HCT116 | Apoptosis Assay | 50 μM | 24h | DMSO | abrogates curcumin-induced cell death | 22101335 |
| Ishikawa | Apoptosis Assay | 25μM | 24h | reduces cell death and apoptosis induced by Baf A1 | 22088918 | |
| YD-8 | Apoptosis Assay | 100μM | 1h | inhibits PLEO-induced apoptosis | 22086183 | |
| eosinophil | Apoptosis Assay | 90μM | 24h | inhibits apoptosis induced by Fas antibody | 22079334 | |
| L929 | Growth Inhibition Assay | 2.5μM | 24h | inhibits the expression of p-p38 and NF-κB to augment TNFα-induced necroptosis and autophagy | 22027097 | |
| YD-8 | Apoptosis Assay | 100μM | 1h | blocks the GS-HCl-induced apoptosis | 22020078 | |
| HBx | Apoptosis Assay | 25μM | 48h | DMSO | reduced cell death induced by 3-MA | 22020078 |
| U937 | Apoptosis Assay | 50 μM | 1h | inhibits HF-induced apoptosis | 21998731 | |
| HL60 | Apoptosis Assay | 40μM | 40min | DMSO | blocks BNDC compounds induce exposure of phosphatidylserine and DNA fragmentation | 21983296 |
| M-14 | Apoptosis Assay | 25μM | 0.5h | inhibits both the crude extract- and compound-induced apoptosis | 21954959 | |
| SK-BR-3 | Apoptosis Assay | 50 μM | 2h | blocks apoptotic DNA fragmentation induced by combination of SM-164 and radiation | 21901386 | |
| MDA-MB-468 | Apoptosis Assay | 50 μM | 2h | blocks apoptotic DNA fragmentation induced by combination of SM-164 and radiation | 21901386 | |
| Cliquez pour voir plus de données expérimentales sur la lignée cellulaire | ||||||
| Poids moléculaire | 467.49 | Formule | C22H30FN3O7 |
Stockage (À compter de la date de réception) | |
|---|---|---|---|---|---|
| N° CAS | 187389-52-2 | Télécharger le SDF | Stockage des solutions mères |
|
|
| Synonymes | Z-VAD(OMe)-FMK | Smiles | CC(C)C(C(=O)NC(C)C(=O)NC(CC(=O)OC)C(=O)CF)NC(=O)OCC1=CC=CC=C1 | ||
|
In vitro |
DMSO
: 93 mg/mL
(198.93 mM)
Ethanol : 2 mg/mL Water : Insoluble |
|
In vivo |
|||||
Étape 1 : Saisir les informations ci-dessous (Recommandé : Un animal supplémentaire pour tenir compte des pertes pendant lexpérience)
Étape 2 : Saisir la formulation in vivo (Ceci est seulement le calculateur, pas la formulation. Veuillez nous contacter dabord sil ny a pas de formulation in vivo dans la section Solubilité.)
Résultats du calcul :
Concentration de travail : mg/ml;
Méthode de préparation du liquide maître DMSO : mg médicament prédissous dans μL DMSO ( Concentration du liquide maître mg/mL, Veuillez nous contacter dabord si la concentration dépasse la solubilité du DMSO du lot de médicament. )
Méthode de préparation de la formulation in vivo : Prendre μL DMSO liquide maître, puis ajouterμL PEG300, mélanger et clarifier, puis ajouterμL Tween 80, mélanger et clarifier, puis ajouter μL ddH2O, mélanger et clarifier.
Méthode de préparation de la formulation in vivo : Prendre μL DMSO liquide maître, puis ajouter μL Huile de maïs, mélanger et clarifier.
Note : 1. Veuillez vous assurer que le liquide est clair avant dajouter le solvant suivant.
2. Assurez-vous dajouter le(s) solvant(s) dans lordre. Vous devez vous assurer que la solution obtenue, lors de lajout précédent, est une solution claire avant de procéder à lajout du solvant suivant. Des méthodes physiques telles que le vortex, les ultrasons ou le bain-marie chaud peuvent être utilisées pour faciliter la dissolution.
| Caractéristiques |
A key compound for apoptosis studies.
|
|---|---|
| Targets/IC50/Ki |
Pan-caspase
(THP.1, Jurkat T-cells) |
| In vitro |
Le Z-VAD-FMK (10 μM) inhibe l'apoptose dans les cellules THP.1. Ce composé (10 μM) inhibe l'activation de l'activité protéase PARP dans les lysats de cellules THP.1 témoins. Il (10 μM) inhibe le traitement du CPP32 dans les cellules THP.1 et Jurkat intactes. Ce produit chimique (50 μM) en cotraitement abolit la morphologie apoptotique des cellules HL60 traitées à la camptothécine. Il (50 μM) bloque la fragmentation de l'ADN induite par la camptothécine dans les cellules HL60. Le composé (50 μM) inhibe la mort cellulaire après l'apoptose induite par l'ARNdb dSMN dans les cellules S2. Il (50 μM) augmente le pourcentage de cellules transfectées survivantes de 26 % à 63 % dans les cellules S2. Cet inhibiteur (> 100 μM) améliore l'apoptose des neutrophiles induite par le TNFα, tandis que des concentrations plus faibles (1-30 μM) bloquent complètement l'apoptose stimulée par le TNFα dans les neutrophiles humains. Il (10 mM) inhibe l'apoptose dans les kératocytes stromaux antérieurs. Le produit chimique (10 mM) inhibe l'apoptose dans les kératocytes stromaux antérieurs détectée par le test TUNEL. |
| In vivo |
L'administration in vivo de Z-VAD-FMK s'est avérée non toxique et a empêché l'apoptose dans des modèles animaux. L'injection intrapéritonéale de HK-GBS entraîne un accouchement prématuré, et le prétraitement avec ce composé retarde l'accouchement prématuré chez les souris. Chez les souris sensibilisées à l'OVA, le traitement avec ce produit chimique inhibe l'infiltration de leucocytes induite par les allergènes. L'injection systémique de ce composé immédiatement avant le défi à l'OVA a réduit l'accumulation de cellules inflammatoires, l'hypersécrétion de mucus et la libération de cytokines Th2 chez les souris sensibilisées/défiées à l'OVA. Le traitement avec ce composé a bloqué la différenciation terminale des cellules épithéliales du cristallin et des kératinocytes, la différenciation des monocytes en macrophages et la différenciation des progéniteurs érythroïdes. Ce produit chimique a atténué l'inflammation et l'hyperréactivité des voies respiratoires induites par les allergènes. Le traitement avec ce composé in vivo a également prévenu l'activation ultérieure des lymphocytes T ex vivo. |
Références |
|
| Méthodes | Biomarqueurs | Images | PMID |
|---|---|---|---|
| Western blot | IRF-1 / p-STAT1 / cleaved PARP1 / cleaved-caspase3 Beclin1 / Atg5 / Atg7 / LC-3I / LC-3II p23 / Hsp90 / hTRET / MMP2 cyto C |
|
27191889 |
| Growth inhibition assay | Cell viability |
|
12522090 |
| Immunofluorescence | cytochrome c Smac/DIABLO Endo G AIF |
|
11726499 |
| ELISA | IL-1β |
|
26254306 |
Question 1:
Can you suggest an in vivo formulation of it for animal studies?
Réponse :
For in vivo study of this compound, the IP formulation is 2% DMSO+35 % PEG 300+2% Tween 80+ddH2O up to 6 mg/ml. The gavage formula is 1%CMC-Na up to 30 mg/ml (suspensions).
Question 2:
What is the difference between S7023 & S8102?
Réponse :
Unlike S7023, it does not require pretreatment with esterase for in vitro studies. This information was cited from the article: https://www.ncbi.nlm.nih.gov/pubmed/16973565.